Difference between revisions of "RXN-15680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12366 == * Synonym(s): == Reactions associated == * RXN-14177 ** pantograph-athaliana == Pathways associated == == External li...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * common name: ** trans-dienel...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_12366 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
 +
* smiles:
 +
** C1(=CC(=O)OC(=CC(=O)[O-])1)
 +
* common name:
 +
** trans-dienelactone
 +
* inchi key:
 +
** InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
 +
* molecular weight:
 +
** 139.087   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-trans-dienelactone
 +
** trans-4-carboxymethylenebut-2-en-1,4-olide
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-14177]]
+
* [[RXN-9868]]
** [[pantograph]]-[[athaliana]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-14177}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543248 9543248]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.7822189.html 7822189]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C12838 C12838]
 +
{{#set: smiles=C1(=CC(=O)OC(=CC(=O)[O-])1)}}
 +
{{#set: common name=trans-dienelactone}}
 +
{{#set: inchi key=InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M}}
 +
{{#set: molecular weight=139.087    }}
 +
{{#set: common name=2-trans-dienelactone|trans-4-carboxymethylenebut-2-en-1,4-olide}}
 +
{{#set: consumed by=RXN-9868}}

Revision as of 15:19, 21 March 2018

Metabolite CPD-10608

  • smiles:
    • C1(=CC(=O)OC(=CC(=O)[O-])1)
  • common name:
    • trans-dienelactone
  • inchi key:
    • InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
  • molecular weight:
    • 139.087
  • Synonym(s):
    • 2-trans-dienelactone
    • trans-4-carboxymethylenebut-2-en-1,4-olide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=CC(=O)OC(=CC(=O)[O-])1)" cannot be used as a page name in this wiki.