Difference between revisions of "PWY-2221"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Gene == Gene Tiso_gene_13636 == * right end position: ** 2095 * transcription direction: ** POSITIVE * left end position: ** 173 * centisome position: ** 2.802073...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_13636 == |
| − | * | + | * right end position: |
| − | ** | + | ** 2095 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 173 |
| − | * | + | * centisome position: |
| − | ** | + | ** 2.8020732 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | + | *** Assignment: ec-number | |
| − | + | ** Source: [[annotation-experimental_annotation]] | |
| − | * | + | *** Assignment: ec-number |
| − | + | == Pathways associated == | |
| − | * [[ | + | |
| − | * | + | |
| − | * | + | |
| − | * | + | |
| − | * | + | |
| − | * [[ | + | |
| − | + | ||
| − | * | + | |
| − | * | + | |
| − | * | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=2095}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: left end position=173}} | |
| − | + | {{#set: centisome position=2.8020732 }} | |
| − | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 15:20, 21 March 2018
Gene Tiso_gene_13636
- right end position:
- 2095
- transcription direction:
- POSITIVE
- left end position:
- 173
- centisome position:
- 2.8020732
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
