Difference between revisions of "DTDPDEHYRHAMREDUCT-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * smiles: ** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2)) * inchi key: ** InChIKey=K...") |
(Created page with "Category:Gene == Gene Tiso_gene_13181 == * right end position: ** 6366 * transcription direction: ** NEGATIVE * left end position: ** 4497 * centisome position: ** 69.3981...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13181 == |
− | * | + | * right end position: |
− | ** | + | ** 6366 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 4497 |
− | * | + | * centisome position: |
− | ** | + | ** 69.39815 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3.5.2.17-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7394]] | ||
+ | * [[PWY-5691]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6366}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=4497}} | |
− | + | {{#set: centisome position=69.39815 }} | |
− | + | {{#set: reaction associated=3.5.2.17-RXN}} | |
− | + | {{#set: pathway associated=PWY-7394|PWY-5691}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:20, 21 March 2018
Gene Tiso_gene_13181
- right end position:
- 6366
- transcription direction:
- NEGATIVE
- left end position:
- 4497
- centisome position:
- 69.39815
- Synonym(s):
Reactions associated
- Reaction: 3.5.2.17-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation