Difference between revisions of "PWY-6398"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...") |
(Created page with "Category:Gene == Gene Tiso_gene_9530 == * right end position: ** 3570 * transcription direction: ** NEGATIVE * left end position: ** 598 * centisome position: ** 6.456489...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_9530 == |
| − | * | + | * right end position: |
| − | ** | + | ** 3570 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 598 |
| − | * | + | * centisome position: |
| − | ** | + | ** 6.456489 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[2.4.1.46-RXN]] | |
| − | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
| − | == | + | *** Assignment: automated-name-match |
| + | ** Source: [[orthology-athaliana]] | ||
| + | * Reaction: [[RXN-16027]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: automated-name-match | ||
| + | == Pathways associated == | ||
| + | * [[PWY-401]] | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=3570}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | + | {{#set: left end position=598}} | |
| − | {{#set: | + | {{#set: centisome position=6.456489 }} |
| − | {{#set: | + | {{#set: reaction associated=2.4.1.46-RXN|RXN-16027}} |
| − | {{#set: | + | {{#set: pathway associated=PWY-401}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:23, 21 March 2018
Gene Tiso_gene_9530
- right end position:
- 3570
- transcription direction:
- NEGATIVE
- left end position:
- 598
- centisome position:
- 6.456489
- Synonym(s):
Reactions associated
- Reaction: 2.4.1.46-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation
- Reaction: RXN-16027
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
