Difference between revisions of "GLYOXDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** histamine degradation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[RXN-10089]] | |
| − | * [[RXN- | + | ** 2 associated gene(s): |
| − | == Reaction(s) | + | *** [[Tiso_gene_3513]] |
| + | *** [[Tiso_gene_7322]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-9600]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_8756]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE-N-METHYLTRANSFERASE-RXN HISTAMINE-N-METHYLTRANSFERASE-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-MAP: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?map00340 map00340] |
| − | {{#set: | + | {{#set: taxonomic range=TAX-33208}} |
| − | + | {{#set: common name=histamine degradation}} | |
| − | {{#set: common name= | + | {{#set: reaction found=2}} |
| − | {{#set: | + | {{#set: total reaction=3}} |
| − | {{#set: | + | {{#set: completion rate=67.0}} |
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:23, 21 March 2018
Pathway PWY-6181
- taxonomic range:
- common name:
- histamine degradation
- Synonym(s):
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- RXN-10089
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-9600
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- LIGAND-MAP:
