Difference between revisions of "ExchangeSeed Pi"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-PHENYLPROPIONATE 3-PHENYLPROPIONATE] == * smiles: ** C(CCC1(=CC=CC=C1))([O-])=O * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1361 PWY-1361] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1361 PWY-1361] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** benzoyl-CoA degradation I (aerobic) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''7''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-2425]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_5857]] | ||
| + | *** [[Tiso_gene_14257]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN0-2044]] | ||
| + | ** 6 associated gene(s): | ||
| + | *** [[Tiso_gene_18839]] | ||
| + | *** [[Tiso_gene_14027]] | ||
| + | *** [[Tiso_gene_14262]] | ||
| + | *** [[Tiso_gene_5857]] | ||
| + | *** [[Tiso_gene_14026]] | ||
| + | *** [[Tiso_gene_18838]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11053 RXN-11053] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11054 RXN-11054] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2401 RXN-2401] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2424 RXN-2424] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3641 RXN-3641] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=benzoyl-CoA degradation I (aerobic)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=29.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:23, 21 March 2018
Pathway PWY-1361
- taxonomic range:
- common name:
- benzoyl-CoA degradation I (aerobic)
- Synonym(s):
Reaction(s) found
2 reactions found over 7 reactions in the full pathway
- RXN-2425
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN0-2044
- 6 associated gene(s):
- 3 reconstruction source(s) associated:
