Difference between revisions of "PWY-7181"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5436 PWY-5436] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == |
− | * | + | * smiles: |
− | ** [ | + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) |
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** chlorophyll a |
+ | * molecular weight: | ||
+ | ** 892.495 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** chlorophyll a (phytol) | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RME294]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-17428]] | |
− | + | * [[R06284]] | |
− | + | * [[RXN-7666]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN1F-66]] | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 479-61-8 |
− | ** [http:// | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657767 90657767] |
− | {{#set: | + | * KNAPSACK : C00001528 |
− | {{#set: common name= | + | * HMDB : HMDB38578 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05306 C05306] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58416 58416] | ||
+ | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | ||
+ | {{#set: common name=chlorophyll a}} | ||
+ | {{#set: molecular weight=892.495 }} | ||
+ | {{#set: common name=chlorophyll a (phytol)}} | ||
+ | {{#set: consumed by=RME294}} | ||
+ | {{#set: produced by=RXN-17428|R06284|RXN-7666}} | ||
+ | {{#set: reversible reaction associated=RXN1F-66}} |
Revision as of 16:24, 21 March 2018
Contents
Metabolite CHLOROPHYLL-A
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- chlorophyll a
- molecular weight:
- 892.495
- Synonym(s):
- chlorophyll a (phytol)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 479-61-8
- PUBCHEM:
- KNAPSACK : C00001528
- HMDB : HMDB38578
- LIGAND-CPD:
- CHEBI:
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.