Difference between revisions of "RXN-5467"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12332 RXN-12332] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12332 RXN-12332] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
+
** [http://enzyme.expasy.org/EC/1.2.1 EC-1.2.1]
−
* common name:
+
−
** D-arabinofuranose 5-phosphate
+
−
* molecular weight:
+
−
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-arabinofuranose 5P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[KDO-8PSYNTH-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-6082]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[B-ALANINE]][c] '''+''' 2 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 3-aminopropanal[c] '''<=>''' 1 NADH[c] '''+''' 1 &beta;-alanine[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7322]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825727 91825727]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30698 30698]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85971 85971]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00904 R00904]
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L}}
+
{{#set: ec number=EC-1.2.1}}
−
{{#set: common name=D-arabinofuranose 5-phosphate}}
+
{{#set: gene associated=Tiso_gene_7322}}
−
{{#set: molecular weight=228.095    }}
+
{{#set: in pathway=}}
−
{{#set: common name=D-arabinofuranose 5P}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: consumed by=KDO-8PSYNTH-RXN}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 15:24, 21 March 2018

Reaction RXN-12332

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 H2O[c] + 1 3-aminopropanal[c] <=> 1 NADH[c] + 1 β-alanine[c] + 2 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-5467&oldid=33971"