Difference between revisions of "PWY-2002"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARG-PRO-PWY ARG-PRO-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARG-PRO-PWY ARG-PRO-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
* common name: | * common name: | ||
− | ** L- | + | ** L-arginine degradation VI (arginase 2 pathway) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** L- | + | ** L-proline biosynthesis from arginine |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''4''' reactions found over '''4''' reactions in the full pathway | |
− | * [[ | + | * [[ARGINASE-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_4415]] |
− | * [[ | + | ** 4 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-in-silico_annotation]] |
− | * [[ | + | *** [[orthology-athaliana]] |
− | * [[ | + | *** [[annotation-experimental_annotation]] |
− | * [[ | + | *** [[orthology-esiliculosus]] |
− | * [[ | + | * [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | + | *** [[Tiso_gene_11231]] | |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * [[ | + | *** [[orthology-synechocystis]] |
− | + | * [[PYRROLINECARBREDUCT-RXN]] | |
− | * [[ | + | ** 4 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_8625]] |
− | * [[ | + | *** [[Tiso_gene_20218]] |
− | * [[ | + | *** [[Tiso_gene_19254]] |
− | * [[ | + | *** [[Tiso_gene_17059]] |
− | * [[ | + | ** 4 reconstruction source(s) associated: |
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[SPONTPRO-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=L-arginine degradation VI (arginase 2 pathway)}} | |
− | + | {{#set: common name=L-proline biosynthesis from arginine}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name=L- | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:24, 21 March 2018
Pathway ARG-PRO-PWY
- taxonomic range:
- common name:
- L-arginine degradation VI (arginase 2 pathway)
- Synonym(s):
- L-proline biosynthesis from arginine
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- ARGINASE-RXN
- 1 associated gene(s):
- 4 reconstruction source(s) associated:
- ORNITHINE-GLU-AMINOTRANSFERASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PYRROLINECARBREDUCT-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- SPONTPRO-RXN
- 0 associated gene:
- 2 reconstruction source(s) associated: