Difference between revisions of "PWY-6322"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11756 CPD-11756] == * smiles: ** C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13935 RXN-13935] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11756 CPD-11756] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13935 RXN-13935] ==
* smiles:
+
* direction:
** C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N
+
** [http://enzyme.expasy.org/EC/2.1.1 EC-2.1.1]
* common name:
+
** 4'-O-demethylrebeccamycin
+
* molecular weight:
+
** 556.358   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10847]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD1F-90]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-14950]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 S-adenosyl-L-methionine[c] '''+''' 1 kaempferol[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 3-O-methylkaempferol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14431]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-7163]], polymethylated kaempferol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7163 PWY-7163]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C19700 C19700]
+
{{#set: ec number=EC-2.1.1}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14431}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=595389 595389]
+
{{#set: in pathway=PWY-7163}}
* PUBCHEM:
+
{{#set: reconstruction category=orthology}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45259192 45259192]
+
{{#set: reconstruction source=orthology-athaliana}}
{{#set: smiles=C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl)}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N}}
+
{{#set: common name=4'-O-demethylrebeccamycin}}
+
{{#set: molecular weight=556.358    }}
+
{{#set: consumed by=RXN-10847}}
+

Revision as of 16:25, 21 March 2018

Reaction RXN-13935

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7163, polymethylated kaempferol biosynthesis: PWY-7163
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links