Difference between revisions of "DIACETYL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_1471 == * right end position: ** 5675 * transcription direction: ** POSITIVE * left end position: ** 3909 * centisome position: ** 16.48810...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1471 == |
− | * | + | * right end position: |
− | ** | + | ** 5675 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3909 |
− | * | + | * centisome position: |
− | ** | + | ** 16.488106 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PMPOXI-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[PNPOXI-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7204]] | ||
+ | * [[PWY-7282]] | ||
+ | * [[PLPSAL-PWY]] | ||
+ | * [[PYRIDOXSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5675}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3909}} | |
− | + | {{#set: centisome position=16.488106 }} | |
− | + | {{#set: reaction associated=PMPOXI-RXN|PNPOXI-RXN}} | |
− | + | {{#set: pathway associated=PWY-7204|PWY-7282|PLPSAL-PWY|PYRIDOXSYN-PWY}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:26, 21 March 2018
Gene Tiso_gene_1471
- right end position:
- 5675
- transcription direction:
- POSITIVE
- left end position:
- 3909
- centisome position:
- 16.488106
- Synonym(s):
Reactions associated
- Reaction: PMPOXI-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: PNPOXI-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation