Difference between revisions of "RXN-11842"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_9392 == * right end position: ** 8809 * transcription direction: ** POSITIVE * left end position: ** 6371 * centisome position: ** 67.87770...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9392 == |
− | * | + | * right end position: |
− | ** | + | ** 8809 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 6371 |
− | * | + | * centisome position: |
− | ** | + | ** 67.87770 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2-DEHYDROPANTOATE-REDUCT-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PANTO-PWY]] | ||
+ | * [[PWY-6654]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8809}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=6371}} |
− | {{#set: | + | {{#set: centisome position=67.87770 }} |
− | {{#set: | + | {{#set: reaction associated=2-DEHYDROPANTOATE-REDUCT-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PANTO-PWY|PWY-6654}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:26, 21 March 2018
Gene Tiso_gene_9392
- right end position:
- 8809
- transcription direction:
- POSITIVE
- left end position:
- 6371
- centisome position:
- 67.87770
- Synonym(s):
Reactions associated
- Reaction: 2-DEHYDROPANTOATE-REDUCT-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation