Difference between revisions of "RXN-10642"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_5014 == * right end position: ** 12902 * transcription direction: ** POSITIVE * left end position: ** 10293 * centisome position: ** 73.468...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5014 == |
− | * | + | * right end position: |
− | ** | + | ** 12902 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 10293 |
− | * | + | * centisome position: |
− | ** | + | ** 73.468956 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | * Reaction: [[UDPGtni]] |
− | == | + | ** Source: [[orthology-creinhardtii]] |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=12902}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=10293}} | |
− | + | {{#set: centisome position=73.468956 }} | |
− | + | {{#set: reaction associated=ATPASE-RXN|UDPGtni}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:26, 21 March 2018
Gene Tiso_gene_5014
- right end position:
- 12902
- transcription direction:
- POSITIVE
- left end position:
- 10293
- centisome position:
- 73.468956
- Synonym(s):
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: UDPGtni
- Source: orthology-creinhardtii