Difference between revisions of "Tiso gene 8531"

Revision as of 15:27, 21 March 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1084 CPD-1084] ==
-* smiles:
-** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))
-* inchi key:
-** InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M
 * common name:
-** tetraiodothyroacetate ester glucuronide
+** perillyl aldehyde
-* molecular weight:
-** 922.95
 * Synonym(s):
-** tetraiodothyroacetic acid ester glucuronide
+** Perillaldehyde
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN-10617]]
 == Reaction(s) of unknown directionality ==
+* [[RXN-14280]]
 == External links  ==
-* PUBCHEM:
+{{#set: common name=perillyl aldehyde}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657880 90657880]
+{{#set: common name=Perillaldehyde}}
-{{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))}}
+{{#set: reversible reaction associated=RXN-14280}}
-{{#set: inchi key=InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M}}
-{{#set: common name=tetraiodothyroacetate ester glucuronide}}
-{{#set: molecular weight=922.95    }}
-{{#set: common name=tetraiodothyroacetic acid ester glucuronide}}
-{{#set: produced by=RXN-10617}}