Difference between revisions of "PWY-6910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13671 RXN-13671] == * direction: ** REVERSIBLE * common name: ** ORF * ec number: ** [http://en...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] == * smiles: ** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13671 RXN-13671] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
 
* common name:
 
* common name:
−
** ORF
+
** 9-cis-violaxanthin
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.2.1.10 EC-1.2.1.10]
+
** InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
 +
* molecular weight:
 +
** 600.88   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9-c-violaxanthin
 +
** 9cViol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7974]]
−
** 1 [[CPD-7000]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[ISOBUTYRYL-COA]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 isobutanal[c] '''+''' 1 NAD+[c] '''+''' 1 coenzyme A[c] '''<=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 isobutanoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7649]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=ORF}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282218 5282218]
−
{{#set: ec number=EC-1.2.1.10}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_7649}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35305 35305]
−
{{#set: in pathway=}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C13433 C13433]
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: smiles=CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=9-cis-violaxanthin}}
 +
{{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N}}
 +
{{#set: molecular weight=600.88    }}
 +
{{#set: common name=9-c-violaxanthin|9cViol}}
 +
{{#set: consumed by=RXN-7974}}

Revision as of 15:28, 21 March 2018

Metabolite CPD-7196

  • smiles:
    • CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
  • common name:
    • 9-cis-violaxanthin
  • inchi key:
    • InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
  • molecular weight:
    • 600.88
  • Synonym(s):
    • 9-c-violaxanthin
    • 9cViol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6910&oldid=34344"