Difference between revisions of "PRACH"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-118 CPD1F-118] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CCCC1(C)C)C))C)C)C=CC=C(C=CC2(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-12 PWY3DJ-12] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-118 CPD1F-118] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-12 PWY3DJ-12] ==
* smiles:
+
* taxonomic range:
** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CCCC1(C)C)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** InChIKey=ANVAOWXLWRTKGA-JLTXGRSLSA-N
+
 
* common name:
 
* common name:
** α-carotene
+
** ceramide de novo biosynthesis
* molecular weight:
+
** 536.882   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-5961]]
+
'''4''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[3-DEHYDROSPHINGANINE-REDUCTASE-RXN]]
* [[RXN1F-148]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_18518]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-16332]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN3DJ-118]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10992]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR01070258
+
{{#set: taxonomic range=TAX-2759}}
* PUBCHEM:
+
{{#set: common name=ceramide de novo biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4369188 4369188]
+
{{#set: reaction found=4}}
* HMDB : HMDB03993
+
{{#set: total reaction=4}}
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C05433 C05433]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.3571861.html 3571861]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28425 28425]
+
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CCCC1(C)C)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}}
+
{{#set: inchi key=InChIKey=ANVAOWXLWRTKGA-JLTXGRSLSA-N}}
+
{{#set: common name=α-carotene}}
+
{{#set: molecular weight=536.882    }}
+
{{#set: consumed by=RXN-5961}}
+
{{#set: produced by=RXN1F-148}}
+

Revision as of 15:29, 21 March 2018

Pathway PWY3DJ-12

  • taxonomic range:
  • common name:
    • ceramide de novo biosynthesis
  • Synonym(s):

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links