Difference between revisions of "ARABCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTONOLACTONE-DEHYDROGENASE-RXN GALACTONOLACTONE-DEHYDROGENASE-RXN] == * direction: ** LEFT-TO-R...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTONOLACTONE-DEHYDROGENASE-RXN GALACTONOLACTONE-DEHYDROGENASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** mitochondrial_l-galactono-_-lactone_dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.2.3 EC-1.3.2.3] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-330]][c] '''+''' 2 [[Cytochromes-C-Oxidized]][c] '''=>''' 1 [[ASCORBATE]][c] '''+''' 3 [[PROTON]][c] '''+''' 2 [[Cytochromes-C-Reduced]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 L-galactono-1,4-lactone[c] '''+''' 2 an oxidized c-type cytochrome[c] '''=>''' 1 L-ascorbate[c] '''+''' 3 H+[c] '''+''' 2 a reduced c-type cytochrome[c] |
− | == | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Tiso_gene_210]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-882]], L-ascorbate biosynthesis I (L-galactose pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] | ||
+ | ** '''6''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00640 R00640] | |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9SU56 Q9SU56] |
− | + | ** [http://www.uniprot.org/uniprot/O47881 O47881] | |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=mitochondrial_l-galactono-_-lactone_dehydrogenase}} | |
− | ** [http://www. | + | {{#set: ec number=EC-1.3.2.3}} |
− | + | {{#set: gene associated=Tiso_gene_210}} | |
− | {{#set: | + | {{#set: in pathway=PWY-882}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:29, 21 March 2018
Contents
Reaction GALACTONOLACTONE-DEHYDROGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- mitochondrial_l-galactono-_-lactone_dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-330[c] + 2 Cytochromes-C-Oxidized[c] => 1 ASCORBATE[c] + 3 PROTON[c] + 2 Cytochromes-C-Reduced[c]
- With common name(s):
- 1 L-galactono-1,4-lactone[c] + 2 an oxidized c-type cytochrome[c] => 1 L-ascorbate[c] + 3 H+[c] + 2 a reduced c-type cytochrome[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_210
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-882, L-ascorbate biosynthesis I (L-galactose pathway): PWY-882
- 6 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links