Difference between revisions of "Tiso gene 9472"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGtni UDPGtni] == * direction: ** LEFT-TO-RIGHT * common name: ** UDP-glucose ABC transporter, nu...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGtni UDPGtni] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QHRGJMIMHCLHRG-ZSELIEHESA-J
+
 
* common name:
 
* common name:
−
** trans-caffeoyl-CoA
+
** UDP-glucose ABC transporter, nuclear
−
* molecular weight:
+
−
** 925.647   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-dihydroxyacryloyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[CPD-12575]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[CPD-12575]][n]
−
* [[RXN-1126]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 ATP[c] '''+''' 1.0 UDP-α-D-glucose[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 ADP[c] '''+''' 1.0 H+[c] '''+''' 1.0 UDP-α-D-glucose[n]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5014]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266599 45266599]
+
{{#set: common name=UDP-glucose ABC transporter, nuclear}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_5014}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57372 57372]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00323 C00323]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=QHRGJMIMHCLHRG-ZSELIEHESA-J}}
+
−
{{#set: common name=trans-caffeoyl-CoA}}
+
−
{{#set: molecular weight=925.647    }}
+
−
{{#set: common name=3,4-dihydroxyacryloyl-CoA}}
+
−
{{#set: consumed by=CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN}}
+
−
{{#set: produced by=RXN-1126}}
+

Revision as of 15:29, 21 March 2018

Reaction UDPGtni

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • UDP-glucose ABC transporter, nuclear
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 UDP-α-D-glucose[c] + 1.0 H2O[c] => 1.0 phosphate[c] + 1.0 ADP[c] + 1.0 H+[c] + 1.0 UDP-α-D-glucose[n]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9472&oldid=34430"