Difference between revisions of "RXN-711"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Gene == Gene Tiso_gene_12516 == * right end position: ** 6146 * transcription direction: ** NEGATIVE * left end position: ** 3982 * centisome position: ** 57.4437...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] ==
+
== Gene Tiso_gene_12516 ==
−
* smiles:
+
* right end position:
−
** CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 6146
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
+
** 3982
−
* molecular weight:
+
* centisome position:
−
** 1104.05    
+
** 57.443737    
 
* Synonym(s):
 
* Synonym(s):
−
** (6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17113]]
+
* Reaction: [[RXN-13588]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6146}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581137 71581137]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=3982}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74084 74084]
+
{{#set: centisome position=57.443737   }}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=RXN-13588}}
−
{{#set: inchi key=InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J}}
+
−
{{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
−
{{#set: molecular weight=1104.05   }}
+
−
{{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-17113}}
+

Revision as of 15:29, 21 March 2018

Gene Tiso_gene_12516

  • right end position:
    • 6146
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3982
  • centisome position:
    • 57.443737
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-711&oldid=34448"