Difference between revisions of "5-10-METHENYL-THF-GLU-N"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-Amines Aryl-Amines] == * common name: ** an arylamine * Synonym(s): ** an aniline == Reac...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-Amines Aryl-Amines] ==
* smiles:
+
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
+
* inchi key:
+
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
+
 
* common name:
 
* common name:
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
+
** an arylamine
* molecular weight:
+
** 185.136   
+
 
* Synonym(s):
 
* Synonym(s):
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
+
** an aniline
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14014]]
+
* [[ARYLAMINE-N-ACETYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIHYDRODIPICSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an arylamine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
+
{{#set: common name=an aniline}}
* CHEBI:
+
{{#set: consumed by=ARYLAMINE-N-ACETYLTRANSFERASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
+
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
+
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
+
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
+
{{#set: molecular weight=185.136    }}
+
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
+
{{#set: consumed by=RXN-14014}}
+
{{#set: produced by=DIHYDRODIPICSYN-RXN}}
+

Revision as of 15:29, 21 March 2018

Metabolite Aryl-Amines

  • common name:
    • an arylamine
  • Synonym(s):
    • an aniline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links