Difference between revisions of "Protein-Red-Disulfides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_6453 == * right end position: ** 3544 * transcription direction: ** POSITIVE * left end position: ** 550 * centisome position: ** 4.5048738...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6453 == |
− | * | + | * right end position: |
− | ** | + | ** 3544 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 550 |
− | * | + | * centisome position: |
− | ** | + | ** 4.5048738 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ADENYLOSUCCINATE-SYNTHASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3544}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=550}} | |
− | + | {{#set: centisome position=4.5048738 }} | |
− | + | {{#set: reaction associated=ADENYLOSUCCINATE-SYNTHASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:31, 21 March 2018
Gene Tiso_gene_6453
- right end position:
- 3544
- transcription direction:
- POSITIVE
- left end position:
- 550
- centisome position:
- 4.5048738
- Synonym(s):
Reactions associated
- Reaction: ADENYLOSUCCINATE-SYNTHASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation