Difference between revisions of "GLYOXIII-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9723 RXN-9723] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9723 RXN-9723] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.77 EC-1.3.1.77] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 3 [[PROTON]][c] '''+''' 1 [[CPD-7090]][c] '''+''' 2 [[NADPH]][c] '''=>''' 2 [[NADP]][c] '''+''' 1 [[CPD-10411]][c] | |
− | + | * With common name(s): | |
− | * [[ | + | ** 3 H+[c] '''+''' 1 delphinidin[c] '''+''' 2 NADPH[c] '''=>''' 2 NADP+[c] '''+''' 1 (-)-epigallocatechin[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_15272]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | * Gene: [[Tiso_gene_9504]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6035]], 2,3-cis-flavanols biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06543 R06543] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.3.1.77}} | |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_15272|Tiso_gene_9504}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-6035}} |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:31, 21 March 2018
Contents
Reaction RXN-9723
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 3 H+[c] + 1 delphinidin[c] + 2 NADPH[c] => 2 NADP+[c] + 1 (-)-epigallocatechin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15272
- Source: orthology-esiliculosus
- Gene: Tiso_gene_9504
- Source: orthology-esiliculosus
Pathways
- PWY-6035, 2,3-cis-flavanols biosynthesis: PWY-6035
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN: