Difference between revisions of "CYSTEAMINE-DIOXYGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...") |
(Created page with "Category:Gene == Gene Tiso_gene_13868 == * Synonym(s): == Reactions associated == * Reaction: RXN-5286 ** Source: orthology-creinhardtii == Pathways associated ==...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_13868 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[RXN-5286]] | |
| − | == | + | ** Source: [[orthology-creinhardtii]] |
| − | * [[ | + | == Pathways associated == |
| + | * [[PWY-5526]] | ||
| + | * [[PWY-7758]] | ||
| + | * [[PWY-7759]] | ||
| + | * [[PWY-5064]] | ||
| + | * [[PWY-5086]] | ||
| + | * [[PWY-7760]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN-5286}} | |
| − | + | {{#set: pathway associated=PWY-5526|PWY-7758|PWY-7759|PWY-5064|PWY-5086|PWY-7760}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 15:31, 21 March 2018
Gene Tiso_gene_13868
- Synonym(s):
Reactions associated
- Reaction: RXN-5286
- Source: orthology-creinhardtii
