Difference between revisions of "GUANINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE MANNOSE] == * common name: ** D-mannose * Synonym(s): == Reaction(s) known to consume...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * common name: *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == |
+ | * smiles: | ||
+ | ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** L-selenocystathionine |
+ | * inchi key: | ||
+ | ** InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N | ||
+ | * molecular weight: | ||
+ | ** 269.159 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12729]] | ||
+ | * [[RXN-15137]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12728]] |
+ | * [[SUCHMSSELCYSLh]] | ||
+ | * [[ACHMSSELCYSL]] | ||
+ | * [[ACHMSSELCYSLh]] | ||
+ | * [[SUCHMSSELCYSL]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921580 52921580] |
+ | * HMDB : HMDB06343 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62226 62226] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699] | ||
+ | {{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}} | ||
+ | {{#set: common name=L-selenocystathionine}} | ||
+ | {{#set: inchi key=InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N}} | ||
+ | {{#set: molecular weight=269.159 }} | ||
+ | {{#set: consumed by=RXN-12729|RXN-15137}} | ||
+ | {{#set: produced by=RXN-12728|SUCHMSSELCYSLh|ACHMSSELCYSL|ACHMSSELCYSLh|SUCHMSSELCYSL}} |
Revision as of 16:31, 21 March 2018
Contents
Metabolite CPD-13717
- smiles:
- C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]
- common name:
- L-selenocystathionine
- inchi key:
- InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N
- molecular weight:
- 269.159
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.