Difference between revisions of "PHTYOSPHINGOSINE-1-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
(Created page with "Category:Gene == Gene Tiso_gene_11479 == * right end position: ** 7636 * transcription direction: ** NEGATIVE * left end position: ** 1817 * centisome position: ** 23.3577...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] ==
+
== Gene Tiso_gene_11479 ==
−
* smiles:
+
* right end position:
−
** [CH](=O)C(C(C(C(CO)O)O)O)O
+
** 7636
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** aldehydo-D-galactose
+
** 1817
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 23.357758    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-1225]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
−
* [[RXN-14409]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-18302]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7840]]
 +
* [[PWY-401]]
 +
* [[PWY-7666]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=7636}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01582 C01582]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=1817}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17118 17118]
+
{{#set: centisome position=23.357758   }}
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-1225|RXN-18302}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3037556 3037556]
+
{{#set: pathway associated=PWY-7840|PWY-401|PWY-7666}}
−
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
+
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N}}
+
−
{{#set: common name=aldehydo-D-galactose}}
+
−
{{#set: molecular weight=180.157   }}
+
−
{{#set: reversible reaction associated=RXN-14409}}
+

Revision as of 15:31, 21 March 2018

Gene Tiso_gene_11479

  • right end position:
    • 7636
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1817
  • centisome position:
    • 23.357758
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PHTYOSPHINGOSINE-1-P&oldid=34652"