Difference between revisions of "GTHP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == * smiles: ** CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10707 RXN-10707] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10707 RXN-10707] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** acyl-coenzyme_a_oxidase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-11525]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-11526]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 oxygen[c] '''+''' 1 OPC4-CoA[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 OPC4-trans-2-enoyl-CoA[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_18566]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735] | ||
| + | ** '''15''' reactions found over '''19''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: common name=acyl-coenzyme_a_oxidase}} |
| − | {{#set: | + | {{#set: ec number=EC-1.3.3.6}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_18566}} |
| − | {{#set: | + | {{#set: in pathway=PWY-735}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
| + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | ||
| + | {{#set: reconstruction tool=pantograph|pathwaytools}} | ||
Revision as of 15:32, 21 March 2018
Contents
Reaction RXN-10707
- direction:
- LEFT-TO-RIGHT
- common name:
- acyl-coenzyme_a_oxidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 CPD-11525[c] => 1 HYDROGEN-PEROXIDE[c] + 1 CPD-11526[c]
- With common name(s):
- 1 oxygen[c] + 1 OPC4-CoA[c] => 1 hydrogen peroxide[c] + 1 OPC4-trans-2-enoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18566
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-735, jasmonic acid biosynthesis: PWY-735
- 15 reactions found over 19 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
