Difference between revisions of "Tiso gene 546"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBONUCLEOSIDE-DIP-REDUCTII-RXN RIBONUCLEOSIDE-DIP-REDUCTII-RXN] == * direction: ** LEFT-TO-RIGHT *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBONUCLEOSIDE-DIP-REDUCTII-RXN RIBONUCLEOSIDE-DIP-REDUCTII-RXN] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J
+
 
* common name:
 
* common name:
−
** 4-cis-undecenoyl-CoA
+
** ribonucleoside-diphosphate_reductase
−
* molecular weight:
+
* ec number:
−
** 929.765   
+
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 4Z-undecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14775]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Reduced-NrdH-Proteins]][c] '''+''' 1 [[CDP]][c] '''=>''' 1 [[DCDP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Oxidized-NrdH-Proteins]][c]
−
* [[RXN-14774]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a reduced NrdH glutaredoxin-like protein[c] '''+''' 1 CDP[c] '''=>''' 1 dCDP[c] '''+''' 1 H2O[c] '''+''' 1 an oxidized NrdH glutaredoxin-like protein[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9915]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10138]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9916]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_10617]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
 +
** '''12''' reactions found over '''17''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658173 90658173]
+
{{#set: common name=ribonucleoside-diphosphate_reductase}}
−
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-1.17.4.1}}
−
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J}}
+
{{#set: gene associated=Tiso_gene_9915|Tiso_gene_10138|Tiso_gene_9916|Tiso_gene_10617}}
−
{{#set: common name=4-cis-undecenoyl-CoA}}
+
{{#set: in pathway=PWY0-166}}
−
{{#set: molecular weight=929.765    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=4Z-undecenoyl-CoA}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
{{#set: consumed by=RXN-14775}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: produced by=RXN-14774}}
+

Revision as of 15:32, 21 March 2018

Reaction RIBONUCLEOSIDE-DIP-REDUCTII-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ribonucleoside-diphosphate_reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-166, superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): PWY0-166
    • 12 reactions found over 17 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_546&oldid=34695"