Difference between revisions of "1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] == * smiles: ** CC(OCC([N+])C(=O)[O-])=O * inchi key: ** InChIKey=VZ...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=a-radical-of-luteolin-7-iOi-diglucuronid a-radical-of-luteolin-7-iOi-diglucuronid] == * common...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=a-radical-of-luteolin-7-iOi-diglucuronid a-radical-of-luteolin-7-iOi-diglucuronid] ==
* smiles:
+
** CC(OCC([N+])C(=O)[O-])=O
+
* inchi key:
+
** InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N
+
 
* common name:
 
* common name:
** O-acetyl-L-serine
+
** a radical of luteolin-7-O-diglucuronide
* molecular weight:
+
** 147.13   
+
 
* Synonym(s):
 
* Synonym(s):
** O3-acetyl-L-serine
 
** acetylserine
 
** O-acetylserine
 
** (2S)-3-acetyloxy-2-aminopropanoate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12726]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SERINE-O-ACETTRAN-RXN]]
+
* [[RXN-15288]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[ACSERLY-RXN]]
 
* [[SULFOCYS-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 66638-22-0
+
{{#set: common name=a radical of luteolin-7-O-diglucuronide}}
* METABOLIGHTS : MTBLC17981
+
{{#set: produced by=RXN-15288}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971051 6971051]
+
* HMDB : HMDB03011
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00979 C00979]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58340 58340]
+
* BIGG : acser
+
{{#set: smiles=CC(OCC([N+])C(=O)[O-])=O}}
+
{{#set: inchi key=InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N}}
+
{{#set: common name=O-acetyl-L-serine}}
+
{{#set: molecular weight=147.13    }}
+
{{#set: common name=O3-acetyl-L-serine|acetylserine|O-acetylserine|(2S)-3-acetyloxy-2-aminopropanoate}}
+
{{#set: consumed by=RXN-12726}}
+
{{#set: produced by=SERINE-O-ACETTRAN-RXN}}
+
{{#set: reversible reaction associated=ACSERLY-RXN|SULFOCYS-RXN}}
+

Revision as of 15:32, 21 March 2018

Metabolite a-radical-of-luteolin-7-iOi-diglucuronid

  • common name:
    • a radical of luteolin-7-O-diglucuronide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links