Difference between revisions of "DOLICHOL-KINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] == * smiles: ** C(=O)([O-])C(=O)CC...")
(Created page with "Category:Gene == Gene Tiso_gene_11323 == * right end position: ** 2621 * transcription direction: ** NEGATIVE * left end position: ** 158 * centisome position: ** 2.006604...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] ==
+
== Gene Tiso_gene_11323 ==
−
* smiles:
+
* right end position:
−
** C(=O)([O-])C(=O)CC(O)C(O)CO
+
** 2621
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 2-dehydro-3-deoxy-D-gluconate
+
** 158
−
* molecular weight:
+
* centisome position:
−
** 177.133    
+
** 2.006604    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-keto-3-deoxy-D-gluconic acid
 
−
** 2-keto-3-deoxy-D-gluconate
 
−
** 3-deoxy-2-oxo-D-gluconate
 
−
** 2-keto-3-deoxygluconate
 
−
** 3-deoxy-D-erythro-hex-2-ulosonic acid
 
−
** KDG
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.2.1.27-RXN]]
−
* [[MANNONDEHYDRAT-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-11213]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-2902]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-1781]]
 +
* [[P562-PWY]]
 +
* [[BETA-ALA-DEGRADATION-I-PWY]]
 +
* [[PWY-7574]]
 +
* [[VALDEG-PWY]]
 +
* [[PWY-5642]]
 
== External links  ==
 
== External links  ==
−
* CAS : 17510-99-5
+
{{#set: right end position=2621}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229111 44229111]
+
{{#set: left end position=158}}
−
* HMDB : HMDB01353
+
{{#set: centisome position=2.006604   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=1.2.1.27-RXN|RXN-11213|RXN-2902}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00204 C00204]
+
{{#set: pathway associated=PWY-1781|P562-PWY|BETA-ALA-DEGRADATION-I-PWY|PWY-7574|VALDEG-PWY|PWY-5642}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57990 57990]
+
−
* BIGG : 2ddglcn
+
−
{{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)CO}}
+
−
{{#set: inchi key=InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M}}
+
−
{{#set: common name=2-dehydro-3-deoxy-D-gluconate}}
+
−
{{#set: molecular weight=177.133   }}
+
−
{{#set: common name=2-keto-3-deoxy-D-gluconic acid|2-keto-3-deoxy-D-gluconate|3-deoxy-2-oxo-D-gluconate|2-keto-3-deoxygluconate|3-deoxy-D-erythro-hex-2-ulosonic acid|KDG}}
+
−
{{#set: produced by=MANNONDEHYDRAT-RXN}}
+

Revision as of 16:32, 21 March 2018

Gene Tiso_gene_11323

  • right end position:
    • 2621
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 158
  • centisome position:
    • 2.006604
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DOLICHOL-KINASE-RXN&oldid=34712"