Difference between revisions of "Tiso gene 11612"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * smiles: ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=L...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTHP GTHP] == * direction: ** LEFT-TO-RIGHT * common name: ** glutathione:hydrogen-peroxide oxidore...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTHP GTHP] ==
−
* smiles:
+
* direction:
−
** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** 3-(6'-methylthio)hexylmalate
+
** glutathione:hydrogen-peroxide oxidoreductase
−
* molecular weight:
+
−
** 262.32   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(6'-methylthio)hexylmalic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXNQT-4174]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[HYDROGEN-PEROXIDE]][c] '''+''' 2.0 [[GLUTATHIONE]][c] '''=>''' 2.0 [[WATER]][c] '''+''' 1.0 [[OXIDIZED-GLUTATHIONE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-18202]]
+
** 1.0 hydrogen peroxide[c] '''+''' 2.0 glutathione[c] '''=>''' 2.0 H2O[c] '''+''' 1.0 glutathione disulfide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6680]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339]
+
{{#set: common name=glutathione:hydrogen-peroxide oxidoreductase}}
−
{{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: gene associated=Tiso_gene_6680}}
−
{{#set: inchi key=InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L}}
+
{{#set: in pathway=}}
−
{{#set: common name=3-(6'-methylthio)hexylmalate}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=262.32    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=3-(6'-methylthio)hexylmalic acid}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXNQT-4174}}
+
−
{{#set: reversible reaction associated=RXN-18202}}
+

Revision as of 15:32, 21 March 2018

Reaction GTHP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • glutathione:hydrogen-peroxide oxidoreductase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11612&oldid=34719"