Difference between revisions of "CPDQT-39"

Revision as of 15:32, 21 March 2018

"CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_15885 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] ==
+* smiles:
+** CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
+* common name:
+** 3-isopropyl-9-(methylthio)-2-oxononanoate
+* inchi key:
+** InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L
+* molecular weight:
+** 260.304
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[RXN-15556]]
+* [[RXN-18203]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***automated-name-match
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
+* [[RXN-18202]]
-* [[PWY-7511]]
 == External links  ==
-{{#set: reaction associated=RXN-15556}}
+{{#set: smiles=CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
-{{#set: pathway associated=PWY-7511}}
+{{#set: common name=3-isopropyl-9-(methylthio)-2-oxononanoate}}
+{{#set: inchi key=InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L}}
+{{#set: molecular weight=260.304    }}
+{{#set: consumed by=RXN-18203}}
+{{#set: reversible reaction associated=RXN-18202}}