Difference between revisions of "Tiso gene 13973"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-237 CPD-237] == * smiles: ** C1(=C(CC(N)=O)C2(=CC=CC=C(N1)2)) * inchi key: ** InChIKey=ZOAM...") |
(Created page with "Category:Gene == Gene Tiso_gene_3718 == * right end position: ** 16010 * transcription direction: ** POSITIVE * left end position: ** 14575 * centisome position: ** 90.331...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3718 == |
− | * | + | * right end position: |
− | ** | + | ** 16010 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 14575 |
− | * | + | * centisome position: |
− | ** | + | ** 90.33158 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[1.1.1.8-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[RXN- | + | *** Assignment: ec-number |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[GLYC3PDEHYDROGBIOSYN-RXN]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6118]] | ||
+ | * [[PWY-7385]] | ||
+ | * [[PWY-7411]] | ||
+ | * [[PWY-5667]] | ||
+ | * [[PWY0-1319]] | ||
+ | * [[PWY-5981]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=16010}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=14575}} | |
− | + | {{#set: centisome position=90.33158 }} | |
− | + | {{#set: reaction associated=1.1.1.8-RXN|GLYC3PDEHYDROGBIOSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-6118|PWY-7385|PWY-7411|PWY-5667|PWY0-1319|PWY-5981}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 15:32, 21 March 2018
Gene Tiso_gene_3718
- right end position:
- 16010
- transcription direction:
- POSITIVE
- left end position:
- 14575
- centisome position:
- 90.33158
- Synonym(s):
Reactions associated
- Reaction: 1.1.1.8-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: GLYC3PDEHYDROGBIOSYN-RXN
- Source: orthology-esiliculosus