Difference between revisions of "RXN-16020"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * smiles: ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) * inchi key: ** InChIKey=JT...") |
(Created page with "Category:Gene == Gene Tiso_gene_450 == * right end position: ** 29312 * transcription direction: ** POSITIVE * left end position: ** 27086 * centisome position: ** 81.0642...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_450 == |
− | * | + | * right end position: |
− | ** | + | ** 29312 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 27086 |
− | * | + | * centisome position: |
− | ** | + | ** 81.064255 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=29312}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=27086}} | |
− | + | {{#set: centisome position=81.064255 }} | |
− | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:32, 21 March 2018
Gene Tiso_gene_450
- right end position:
- 29312
- transcription direction:
- POSITIVE
- left end position:
- 27086
- centisome position:
- 81.064255
- Synonym(s):
Reactions associated
- Reaction: NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation