Difference between revisions of "Tiso gene 12104"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4303 RXN-4303] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4303 RXN-4303] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.5.1.112 EC-2.5.1.112]
+
** OPC6-3-hydroxyacyl-CoA
 +
* inchi key:
 +
** InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J
 +
* molecular weight:
 +
** 1027.866   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10702]]
−
** 1 [[CPD-4211]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-4201]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-10704]]
−
** 1 dimethylallyl diphosphate[c] '''+''' 1 ATP[c] '''+''' 1 H+[c] '''=>''' 1 diphosphate[c] '''+''' 1 N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3274]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-2681]], trans-zeatin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2681 PWY-2681]
+
−
** '''2''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08051 R08051]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237226 44237226]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
−
{{#set: ec number=EC-2.5.1.112}}
+
{{#set: common name=OPC6-3-hydroxyacyl-CoA}}
−
{{#set: gene associated=Tiso_gene_3274}}
+
{{#set: inchi key=InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J}}
−
{{#set: in pathway=PWY-2681}}
+
{{#set: molecular weight=1027.866    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN-10702}}
−
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
+
{{#set: produced by=RXN-10704}}
−
{{#set: reconstruction tool=pantograph}}
+

Revision as of 15:32, 21 March 2018

Metabolite CPD-11523

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • common name:
    • OPC6-3-hydroxyacyl-CoA
  • inchi key:
    • InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J
  • molecular weight:
    • 1027.866
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12104&oldid=34740"