Difference between revisions of "Tiso gene 11164"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Primary-Aliphatic-Amides Primary-Aliphatic-Amides] == * common name: ** a primary aliphatic ami...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Primary-Aliphatic-Amides Primary-Aliphatic-Amides] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O)C1(=CC=CC=C1))CC(=O)[O-])COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
* inchi key:
+
** InChIKey=SGNPJINSCKFITG-IHEBCORQSA-I
+
 
* common name:
 
* common name:
** benzoylsuccinyl-CoA
+
** a primary aliphatic amide
* molecular weight:
+
** 966.676   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-905]]
+
* [[NITRILE-HYDRATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a primary aliphatic amide}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659089 90659089]
+
{{#set: produced by=NITRILE-HYDRATASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28882 28882]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C09820 C09820]
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O)C1(=CC=CC=C1))CC(=O)[O-])COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=SGNPJINSCKFITG-IHEBCORQSA-I}}
+
{{#set: common name=benzoylsuccinyl-CoA}}
+
{{#set: molecular weight=966.676    }}
+
{{#set: produced by=RXN-905}}
+

Revision as of 15:33, 21 March 2018

Metabolite Primary-Aliphatic-Amides

  • common name:
    • a primary aliphatic amide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links