Difference between revisions of "Tiso gene 6189"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...") |
(Created page with "Category:Gene == Gene Tiso_gene_2589 == * right end position: ** 7238 * transcription direction: ** POSITIVE * left end position: ** 5571 * centisome position: ** 29.63928...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2589 == |
− | * | + | * right end position: |
− | ** | + | ** 7238 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5571 |
− | * | + | * centisome position: |
− | ** | + | ** 29.639286 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[1.11.1.15-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[RXN0-5468]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7238}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5571}} | |
− | + | {{#set: centisome position=29.639286 }} | |
− | + | {{#set: reaction associated=1.11.1.15-RXN|RXN0-5468}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 15:33, 21 March 2018
Gene Tiso_gene_2589
- right end position:
- 7238
- transcription direction:
- POSITIVE
- left end position:
- 5571
- centisome position:
- 29.639286
- Synonym(s):
Reactions associated
- Reaction: 1.11.1.15-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN0-5468
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation