Difference between revisions of "LIPID-IV-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] == * smiles: ** C2(C=CC1(=C(C=CN1)C=2)) * inchi key: ** InChIKey=SIKJAQJRHWYJAI-...")
(Created page with "Category:Gene == Gene Tiso_gene_17141 == * right end position: ** 3084 * transcription direction: ** NEGATIVE * left end position: ** 461 * centisome position: ** 6.504868...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] ==
+
== Gene Tiso_gene_17141 ==
−
* smiles:
+
* right end position:
−
** C2(C=CC1(=C(C=CN1)C=2))
+
** 3084
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** indole
+
** 461
−
* molecular weight:
+
* centisome position:
−
** 117.15    
+
** 6.504868    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-2382]]
+
* Reaction: [[R03845]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-synechocystis]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-5285]]
−
* [[RXN0-2381]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN1F-10]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[CHLOROPHYLL-SYN]]
 
== External links  ==
 
== External links  ==
−
* CAS : 120-72-9
+
{{#set: right end position=3084}}
−
* DRUGBANK : DB04532
+
{{#set: transcription direction=NEGATIVE}}
−
* PUBCHEM:
+
{{#set: left end position=461}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=798 798]
+
{{#set: centisome position=6.504868   }}
−
* HMDB : HMDB00738
+
{{#set: reaction associated=R03845|RXN-5285|RXN1F-10}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=CHLOROPHYLL-SYN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00463 C00463]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.776.html 776]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16881 16881]
+
−
* BIGG : indole
+
−
{{#set: smiles=C2(C=CC1(=C(C=CN1)C=2))}}
+
−
{{#set: inchi key=InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N}}
+
−
{{#set: common name=indole}}
+
−
{{#set: molecular weight=117.15   }}
+
−
{{#set: consumed by=RXN0-2382}}
+
−
{{#set: reversible reaction associated=RXN0-2381}}
+

Revision as of 15:33, 21 March 2018

Gene Tiso_gene_17141

  • right end position:
    • 3084
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 461
  • centisome position:
    • 6.504868
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=LIPID-IV-A&oldid=34846"