Difference between revisions of "Red-NADPH-Hemoprotein-Reductases"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10958 == * Synonym(s): == Reactions associated == * SPMDtmi ** pantograph-creinhardtii * TRANS-RXN-261 ** pantograph-[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C | ||
| + | * common name: | ||
| + | ** 7,9,9'-cis-neurosporene | ||
| + | * inchi key: | ||
| + | ** InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N | ||
| + | * molecular weight: | ||
| + | ** 538.898 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** proneurosporene | ||
| + | ** 7,9,9'-tri-cis-neurosporene | ||
| + | ** 7,9,9'-tricis-neurosporene | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11357]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-11356]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C19759 C19759] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62463 62463] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244751 25244751] | ||
| + | {{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}} | ||
| + | {{#set: common name=7,9,9'-cis-neurosporene}} | ||
| + | {{#set: inchi key=InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N}} | ||
| + | {{#set: molecular weight=538.898 }} | ||
| + | {{#set: common name=proneurosporene|7,9,9'-tri-cis-neurosporene|7,9,9'-tricis-neurosporene}} | ||
| + | {{#set: consumed by=RXN-11357}} | ||
| + | {{#set: produced by=RXN-11356}} | ||
Revision as of 15:33, 21 March 2018
Contents
Metabolite CPD-7524
- smiles:
- CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
- common name:
- 7,9,9'-cis-neurosporene
- inchi key:
- InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N
- molecular weight:
- 538.898
- Synonym(s):
- proneurosporene
- 7,9,9'-tri-cis-neurosporene
- 7,9,9'-tricis-neurosporene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
