Difference between revisions of "RXN-16103"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHRT_ibcoa DHRT_ibcoa] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrolipoyllysine-resid...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHRT_ibcoa DHRT_ibcoa] ==
* smiles:
+
* direction:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N
+
 
* common name:
 
* common name:
** teasterone
+
** dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, Isobutyryl-CoA forming
* molecular weight:
+
** 448.685   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-717]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CPD-281]][m] '''+''' 1.0 [[CO-A]][m] '''=>''' 1.0 [[DIHYDROLIPOAMIDE]][m] '''+''' 1.0 [[ISOBUTYRYL-COA]][m]
* [[RXN-716]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 S-(2-methylpropanoyl)-dihydrolipoamide[m] '''+''' 1.0 coenzyme A[m] '''=>''' 1.0 dihydrolipoamide[m] '''+''' 1.0 isobutanoyl-CoA[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11793]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13475125 13475125]
+
{{#set: common name=dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, Isobutyryl-CoA forming}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_11793}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=26863 26863]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C15791 C15791]
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N}}
+
{{#set: common name=teasterone}}
+
{{#set: molecular weight=448.685    }}
+
{{#set: consumed by=RXN-717}}
+
{{#set: produced by=RXN-716}}
+

Revision as of 15:34, 21 March 2018

Reaction DHRT_ibcoa

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, Isobutyryl-CoA forming
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 S-(2-methylpropanoyl)-dihydrolipoamide[m] + 1.0 coenzyme A[m] => 1.0 dihydrolipoamide[m] + 1.0 isobutanoyl-CoA[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links