Difference between revisions of "MAP-Kinase-L-Phosphotyrosine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] == * smiles: ** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATP_3h_th ATP_3h_th] == * direction: ** LEFT-TO-RIGHT * common name: ** ADP/ATP transporter, chloro...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATP_3h_th ATP_3h_th] ==
−
* smiles:
+
* direction:
−
** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N
+
 
* common name:
 
* common name:
−
** pregn-5-ene-3,20-dione
+
** ADP/ATP transporter, chloroplast
−
* molecular weight:
+
−
** 314.467   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN66-353]]
+
** 1.0 [[ATP]][h] '''+''' 1.0 [[ADP]][c] '''+''' 3.0 [[PROTON]][c] '''=>''' 1.0 [[ADP]][h] '''+''' 3.0 [[PROTON]][h] '''+''' 1.0 [[ATP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 ATP[h] '''+''' 1.0 ADP[c] '''+''' 3.0 H+[c] '''=>''' 1.0 ADP[h] '''+''' 3.0 H+[h] '''+''' 1.0 ATP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2774]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=150901 150901]
+
{{#set: common name=ADP/ATP transporter, chloroplast}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_2774}}
−
** [http://www.chemspider.com/Chemical-Structure.546029.html 546029]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63837 63837]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N}}
+
−
{{#set: common name=pregn-5-ene-3,20-dione}}
+
−
{{#set: molecular weight=314.467    }}
+
−
{{#set: produced by=RXN66-353}}
+

Revision as of 15:34, 21 March 2018

Reaction ATP_3h_th

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ADP/ATP transporter, chloroplast
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[h] + 1.0 ADP[c] + 3.0 H+[c] => 1.0 ADP[h] + 3.0 H+[h] + 1.0 ATP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=MAP-Kinase-L-Phosphotyrosine&oldid=34906"