Difference between revisions of "3-Hydroxy-octanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6563 == * left end position: ** 2548 * transcription direction: ** POSITIVE * right end position: ** 3640 * centisome position: ** 21.14347...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] == * smiles: ** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_6563 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] ==
* left end position:
+
* smiles:
** 2548
+
** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** (9Z)-tetradecenoyl-CoA
* right end position:
+
* inchi key:
** 3640
+
** InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J
* centisome position:
+
* molecular weight:
** 21.143475    
+
** 971.845    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[1.2.1.31-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-16561]]
***ec-number
+
== Reaction(s) of unknown directionality ==
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[ALCOHOL-DEHYDROG-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[ALLYSINE-DEHYDROG-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10781]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10855]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10911]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10915]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-12448]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-12560]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-13198]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-13279]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-5424]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-5901]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7644]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7657]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7693]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7694]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7700]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7706]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-8162]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN3O-4113]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN66-478]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY66-21]]
+
* [[PWY-7111]]
+
* [[PWY-6587]]
+
* [[PWY-5676]]
+
* [[PWY-5082]]
+
* [[PWY-7118]]
+
* [[PWY-7013]]
+
* [[PWY-3162]]
+
* [[PWY-5751]]
+
* [[PWY-6342]]
+
* [[PWY1-3]]
+
* [[PWY-5283]]
+
* [[P161-PWY]]
+
* [[ETOH-ACETYLCOA-ANA-PWY]]
+
* [[FERMENTATION-PWY]]
+
* [[PWY-6871]]
+
* [[PWY-7396]]
+
* [[PWY-5057]]
+
* [[PWY-5741]]
+
* [[PWY-5076]]
+
* [[PWY-6333]]
+
* [[PWY-5486]]
+
* [[PWY-5079]]
+
* [[PWY-5078]]
+
* [[PWY-6313]]
+
* [[PWY66-425]]
+
* [[PWY-5480]]
+
* [[PWY-5298]]
+
* [[PWY3O-4108]]
+
* [[PWY-7216]]
+
* [[PWY-6802]]
+
* [[LYSINE-DEG1-PWY]]
+
* [[P122-PWY]]
+
* [[PWY66-389]]
+
* [[PWY4LZ-257]]
+
* [[PWY-4101]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2548}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678739 70678739]
{{#set: right end position=3640}}
+
* CHEBI:
{{#set: centisome position=21.143475    }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65060 65060]
{{#set: reaction associated=1.2.1.31-RXN|ALCOHOL-DEHYDROG-GENERIC-RXN|ALCOHOL-DEHYDROG-RXN|ALLYSINE-DEHYDROG-RXN|L-IDITOL-2-DEHYDROGENASE-RXN|PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN|RXN-10781|RXN-10855|RXN-10911|RXN-10915|RXN-12448|RXN-12560|RXN-13198|RXN-13279|RXN-5424|RXN-5901|RXN-7644|RXN-7657|RXN-7693|RXN-7694|RXN-7700|RXN-7706|RXN-8162|RXN3O-4113|RXN66-478}}
+
{{#set: smiles=CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: pathway associated=PWY66-21|PWY-7111|PWY-6587|PWY-5676|PWY-5082|PWY-7118|PWY-7013|PWY-3162|PWY-5751|PWY-6342|PWY1-3|PWY-5283|P161-PWY|ETOH-ACETYLCOA-ANA-PWY|FERMENTATION-PWY|PWY-6871|PWY-7396|PWY-5057|PWY-5741|PWY-5076|PWY-6333|PWY-5486|PWY-5079|PWY-5078|PWY-6313|PWY66-425|PWY-5480|PWY-5298|PWY3O-4108|PWY-7216|PWY-6802|LYSINE-DEG1-PWY|P122-PWY|PWY66-389|PWY4LZ-257|PWY-4101}}
+
{{#set: common name=(9Z)-tetradecenoyl-CoA}}
 +
{{#set: inchi key=InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J}}
 +
{{#set: molecular weight=971.845    }}
 +
{{#set: produced by=RXN-16561}}

Revision as of 15:34, 21 March 2018

Metabolite CPD-17464

  • smiles:
    • CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • (9Z)-tetradecenoyl-CoA
  • inchi key:
    • InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J
  • molecular weight:
    • 971.845
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.