Difference between revisions of "CPD0-2354"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18330 == * left end position: ** 2238 * transcription direction: ** POSITIVE * right end position: ** 3062 * centisome position: ** 72.4740...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * common name: |
| − | ** | + | ** 24-methylenelophenol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 412.698 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4α-methyl-5α-ergosta-7,24-dien-3β-ol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[1. | + | * [[2.1.1.143-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283640 5283640] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29107 29107] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11522 C11522] |
| + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=24-methylenelophenol}} | ||
| + | {{#set: inchi key=InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N}} | ||
| + | {{#set: molecular weight=412.698 }} | ||
| + | {{#set: common name=4α-methyl-5α-ergosta-7,24-dien-3β-ol}} | ||
| + | {{#set: consumed by=2.1.1.143-RXN}} | ||
Revision as of 15:35, 21 March 2018
Contents
Metabolite CPD-4101
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 24-methylenelophenol
- inchi key:
- InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
- molecular weight:
- 412.698
- Synonym(s):
- 4α-methyl-5α-ergosta-7,24-dien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
