Difference between revisions of "Tiso gene 19356"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] == * smiles: ** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=...")
(Created page with "Category:Gene == Gene Tiso_gene_7205 == * right end position: ** 2707 * transcription direction: ** NEGATIVE * left end position: ** 146 * centisome position: ** 1.2810389...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] ==
+
== Gene Tiso_gene_7205 ==
−
* smiles:
+
* right end position:
−
** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
+
** 2707
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate
+
** 146
−
* molecular weight:
+
* centisome position:
−
** 380.17    
+
** 1.2810389    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-5021]]
−
* [[RXN-15733]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2707}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657876 90657876]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}}
+
{{#set: left end position=146}}
−
{{#set: inchi key=InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K}}
+
{{#set: centisome position=1.2810389   }}
−
{{#set: common name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate}}
+
{{#set: reaction associated=RXN0-5021}}
−
{{#set: molecular weight=380.17   }}
+
−
{{#set: produced by=RXN-15733}}
+

Revision as of 15:35, 21 March 2018

Gene Tiso_gene_7205

  • right end position:
    • 2707
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 146
  • centisome position:
    • 1.2810389
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19356&oldid=35022"