Difference between revisions of "RXN-14394"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42. RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NAD...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42. RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42.] ==
* smiles:
+
* direction:
** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
+
* common name:
+
** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
+
* molecular weight:
+
** 334.43   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-13677]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CPD-14719]][c] '''+''' 1.0 [[WATER]][c] '''+''' 1.0 [[NAD]][c] '''=>''' 2.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c] '''+''' 1.0 [[CPD-7830]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 heptadecanal[c] '''+''' 1.0 H2O[c] '''+''' 1.0 NAD+[c] '''=>''' 2.0 H+[c] '''+''' 1.0 NADH[c] '''+''' 1.0 heptadecanoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346]
+
{{#set: in pathway=}}
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}}
+
{{#set: reconstruction category=gap-filling}}
{{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}}
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
{{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}}
+
{{#set: reconstruction tool=meneco}}
{{#set: molecular weight=334.43    }}
+
{{#set: reconstruction comment=added for gapfilling}}
{{#set: consumed by=RXN-13677}}
+

Revision as of 15:35, 21 March 2018

Reaction RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42.

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 heptadecanal[c] + 1.0 H2O[c] + 1.0 NAD+[c] => 2.0 H+[c] + 1.0 NADH[c] + 1.0 heptadecanoate[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links