Difference between revisions of "RXN-9985"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2762 RXN-2762] == * direction: ** LEFT-TO-RIGHT * common name: ** mpbq_msbq_methyltransferase *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * com...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2762 RXN-2762] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
 
* common name:
 
* common name:
−
** mpbq_msbq_methyltransferase
+
** (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.1.1.295 EC-2.1.1.295]
+
** InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
 +
* molecular weight:
 +
** 382.542   
 
* Synonym(s):
 
* Synonym(s):
 +
** C25-allenic-apo-aldehyde
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[2-METHYL-6-SOLANYL-14-BENZOQUINONE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-12829]][c]
+
* [[RXN-698]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 S-adenosyl-L-methionine[c] '''+''' 1 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c] '''+''' 1 plastoquinol-9[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2596]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-1581]], plastoquinol-9 biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1581 PWY-1581]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6978]], plastoquinol-9 biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6978 PWY-6978]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=mpbq_msbq_methyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245424 25245424]
−
{{#set: ec number=EC-2.1.1.295}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_2596}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34596 34596]
−
{{#set: in pathway=PWY-1581|PWY-6978}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C14044 C14044]
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: smiles=CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=(3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}}
 +
{{#set: inchi key=InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N}}
 +
{{#set: molecular weight=382.542    }}
 +
{{#set: common name=C25-allenic-apo-aldehyde}}
 +
{{#set: produced by=RXN-698}}

Revision as of 15:35, 21 March 2018

Metabolite CPD1F-4

  • smiles:
    • CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
  • common name:
    • (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
  • inchi key:
    • InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
  • molecular weight:
    • 382.542
  • Synonym(s):
    • C25-allenic-apo-aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9985&oldid=35078"