Difference between revisions of "RXN-10625"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-seryl-SEC-tRNAs L-seryl-SEC-tRNAs] == * common name: ** an L-seryl-[tRNAsec] * Synonym(s): =...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-seryl-SEC-tRNAs L-seryl-SEC-tRNAs] ==
* smiles:
+
** CC1(=NC=C(CO)C(C[N+])=C(O)1)
+
* inchi key:
+
** InChIKey=NHZMQXZHNVQTQA-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** pyridoxamine
+
** an L-seryl-[tRNAsec]
* molecular weight:
+
** 169.203   
+
 
* Synonym(s):
 
* Synonym(s):
** PM
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PYRAMKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYAMPP]]
+
* [[RXN0-2161]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-10038]]
 
== External links  ==
 
== External links  ==
* CAS : 85-87-0
+
{{#set: common name=an L-seryl-[tRNAsec]}}
* METABOLIGHTS : MTBLC57761
+
{{#set: produced by=RXN0-2161}}
* PUBCHEM:
+
{{#set: reversible reaction associated=RXN-10038}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245492 25245492]
+
* HMDB : HMDB01431
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00534 C00534]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57761 57761]
+
* BIGG : pydam
+
{{#set: smiles=CC1(=NC=C(CO)C(C[N+])=C(O)1)}}
+
{{#set: inchi key=InChIKey=NHZMQXZHNVQTQA-UHFFFAOYSA-O}}
+
{{#set: common name=pyridoxamine}}
+
{{#set: molecular weight=169.203    }}
+
{{#set: common name=PM}}
+
{{#set: consumed by=PYRAMKIN-RXN}}
+
{{#set: produced by=PYAMPP}}
+

Revision as of 16:36, 21 March 2018

Metabolite L-seryl-SEC-tRNAs

  • common name:
    • an L-seryl-[tRNAsec]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-seryl-[tRNAsec" cannot be used as a page name in this wiki.