Difference between revisions of "RXN-13602"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == * smiles: ** C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-]) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_17558 == * right end position: ** 1941 * transcription direction: ** POSITIVE * left end position: ** 1280 * centisome position: ** 35.3982...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17558 == |
− | * | + | * right end position: |
− | ** | + | ** 1941 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1280 |
− | * | + | * centisome position: |
− | ** | + | ** 35.39823 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3.2.1.23-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[BETAGALACTOSID-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[KETOLACTOSE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-12398]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-12399]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-12400]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6807]] | ||
+ | * [[BGALACT-PWY]] | ||
+ | * [[LACTOSEUTIL-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1941}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1280}} | |
− | + | {{#set: centisome position=35.39823 }} | |
− | + | {{#set: reaction associated=3.2.1.23-RXN|BETAGALACTOSID-RXN|KETOLACTOSE-RXN|RNA-DIRECTED-DNA-POLYMERASE-RXN|RXN-12398|RXN-12399|RXN-12400}} | |
− | + | {{#set: pathway associated=PWY-6807|BGALACT-PWY|LACTOSEUTIL-PWY}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 15:37, 21 March 2018
Gene Tiso_gene_17558
- right end position:
- 1941
- transcription direction:
- POSITIVE
- left end position:
- 1280
- centisome position:
- 35.39823
- Synonym(s):
Reactions associated
- Reaction: 3.2.1.23-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: BETAGALACTOSID-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: KETOLACTOSE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12398
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12399
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12400
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation