Difference between revisions of "CPD1G-773"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HEME-OXYGENASE-DECYCLIZING-RXN HEME-OXYGENASE-DECYCLIZING-RXN] == * direction: ** LEFT-TO-RIGHT * c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HEME-OXYGENASE-DECYCLIZING-RXN HEME-OXYGENASE-DECYCLIZING-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.14.14.18 EC-1.14.14.18] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[PROTOHEME]][c] '''+''' 2 [[PROTON]][c] '''+''' 3 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 3 [[OXYGEN-MOLECULE]][c] '''=>''' 3 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[FE+2]][c] '''+''' 1 [[CARBON-MONOXIDE]][c] '''+''' 1 [[BILIVERDINE]][c] '''+''' 3 [[WATER]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ferroheme b[c] '''+''' 2 H+[c] '''+''' 3 a reduced [NADPH-hemoprotein reductase][c] '''+''' 3 oxygen[c] '''=>''' 3 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 Fe2+[c] '''+''' 1 carbon monoxide[c] '''+''' 1 biliverdin-IX-α[c] '''+''' 3 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_19364]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5874]], heme degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5874 PWY-5874] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00311 R00311] |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P23711 P23711] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P14901 P14901] |
− | * | + | ** [http://www.uniprot.org/uniprot/P30519 P30519] |
− | * | + | ** [http://www.uniprot.org/uniprot/P06762 P06762] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P09601 P09601] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M338 Q7M338] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P14791 P14791] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P32394 P32394] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P72849 P72849] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P74133 P74133] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9RKR1 Q9RKR1] |
+ | ** [http://www.uniprot.org/uniprot/O48782 O48782] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=ORF}} | ||
+ | {{#set: ec number=EC-1.14.14.18}} | ||
+ | {{#set: gene associated=Tiso_gene_19364}} | ||
+ | {{#set: in pathway=PWY-5874}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 15:37, 21 March 2018
Contents
Reaction HEME-OXYGENASE-DECYCLIZING-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTOHEME[c] + 2 PROTON[c] + 3 Red-NADPH-Hemoprotein-Reductases[c] + 3 OXYGEN-MOLECULE[c] => 3 Ox-NADPH-Hemoprotein-Reductases[c] + 1 FE+2[c] + 1 CARBON-MONOXIDE[c] + 1 BILIVERDINE[c] + 3 WATER[c]
- With common name(s):
- 1 ferroheme b[c] + 2 H+[c] + 3 a reduced [NADPH-hemoprotein reductase][c] + 3 oxygen[c] => 3 an oxidized [NADPH-hemoprotein reductase][c] + 1 Fe2+[c] + 1 carbon monoxide[c] + 1 biliverdin-IX-α[c] + 3 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_19364
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
- UNIPROT: