Difference between revisions of "DTDP-DEOH-DEOXY-GLUCOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))O * inchi key: ** InC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1772 CPD-1772] == * smiles: ** C([N+])[CH]=O * common name: ** 2-aminoacetaldehyde * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1772 CPD-1772] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C([N+])[CH]=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-aminoacetaldehyde |
+ | * inchi key: | ||
+ | ** InChIKey=LYIIBVSRGJSHAV-UHFFFAOYSA-O | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 60.075 |
* Synonym(s): | * Synonym(s): | ||
+ | ** aminoacetaldehyde | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-299]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=18706033 18706033] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58213 58213] |
− | * BIGG : | + | * BIGG : aacald |
− | {{#set: smiles=C( | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06735 C06735] |
− | {{#set: | + | {{#set: smiles=C([N+])[CH]=O}} |
− | {{#set: molecular weight= | + | {{#set: common name=2-aminoacetaldehyde}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LYIIBVSRGJSHAV-UHFFFAOYSA-O}} |
− | {{#set: produced by= | + | {{#set: molecular weight=60.075 }} |
+ | {{#set: common name=aminoacetaldehyde}} | ||
+ | {{#set: produced by=RXN0-299}} |
Revision as of 15:37, 21 March 2018
Contents
Metabolite CPD-1772
- smiles:
- C([N+])[CH]=O
- common name:
- 2-aminoacetaldehyde
- inchi key:
- InChIKey=LYIIBVSRGJSHAV-UHFFFAOYSA-O
- molecular weight:
- 60.075
- Synonym(s):
- aminoacetaldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])[CH]=O" cannot be used as a page name in this wiki.