Difference between revisions of "Tiso gene 17196"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...")
(Created page with "Category:Gene == Gene Tiso_gene_14085 == * right end position: ** 4742 * transcription direction: ** NEGATIVE * left end position: ** 2082 * centisome position: ** 35.5411...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
+
== Gene Tiso_gene_14085 ==
−
* smiles:
+
* right end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
+
** 4742
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 5α-cholesta-8-en-3-one
+
** 2082
−
* molecular weight:
+
* centisome position:
−
** 384.644    
+
** 35.54114    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN66-23]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4742}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263324 44263324]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=2082}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87056 87056]
+
{{#set: centisome position=35.54114   }}
−
* HMDB : HMDB12178
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}}
+
−
{{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}}
+
−
{{#set: common name=5α-cholesta-8-en-3-one}}
+
−
{{#set: molecular weight=384.644   }}
+
−
{{#set: produced by=RXN66-23}}
+

Revision as of 15:38, 21 March 2018

Gene Tiso_gene_14085

  • right end position:
    • 4742
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 2082
  • centisome position:
    • 35.54114
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17196&oldid=35295"